C23H25N3O6S3 — CID 3997101
N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 3997101) has the molecular formula C23H25N3O6S3 and a molecular weight of 535.67 g/mol. Its IUPAC name is N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 3997101 |
| Molecular Formula | C23H25N3O6S3 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-(5-morpholin-4-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)Cc2ccc(S(=O)(=O)N3CCOCC3)s2)c1 |
| InChI | InChI=1S/C23H25N3O6S3/c1-25(19-7-3-2-4-8-19)34(28,29)21-9-5-6-18(16-21)24-22(27)17-20-10-11-23(33-20)35(30,31)26-12-14-32-15-13-26/h2-11,16H,12-15,17H2,1H3,(H,24,27) |
| InChIKey | CWESFNDIHDFEHG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |