C20H19ClN2O5S2 — CID 41312007
5-(2-chlorophenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]furan-2-carboxamide (PubChem CID 41312007) has the molecular formula C20H19ClN2O5S2 and a molecular weight of 466.97 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41312007 |
| Molecular Formula | C20H19ClN2O5S2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)s1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C20H19ClN2O5S2/c21-16-4-2-1-3-15(16)17-6-7-18(28-17)20(24)22-13-14-5-8-19(29-14)30(25,26)23-9-11-27-12-10-23/h1-8H,9-13H2,(H,22,24) |
| InChIKey | AYEUEXLMYOGFPS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |