C13H16N2O7S2 — CID 18277675
methyl 3-[2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 18277675) has the molecular formula C13H16N2O7S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 3-[2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18277675 |
| Molecular Formula | C13H16N2O7S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | methyl 3-[2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)CC1C(=O)NCCN1S(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C13H16N2O7S2/c1-21-10(16)7-8-12(17)14-4-5-15(8)24(19,20)9-3-6-23-11(9)13(18)22-2/h3,6,8H,4-5,7H2,1-2H3,(H,14,17) |
| InChIKey | SPIWOTAOORIXCC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |