C13H15BrN2O5S — CID 17404766
methyl 2-[1-(3-bromophenyl)sulfonyl-3-oxopiperazin-2-yl]acetate (PubChem CID 17404766) has the molecular formula C13H15BrN2O5S and a molecular weight of 391.24 g/mol. Its IUPAC name is methyl 2-[1-(3-bromophenyl)sulfonyl-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-(3-bromophenyl)sulfonyl-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17404766 |
| Molecular Formula | C13H15BrN2O5S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | methyl 2-[1-(3-bromophenyl)sulfonyl-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O5S/c1-21-12(17)8-11-13(18)15-5-6-16(11)22(19,20)10-4-2-3-9(14)7-10/h2-4,7,11H,5-6,8H2,1H3,(H,15,18) |
| InChIKey | OVITVYBVOAKCOY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |