C18H19N3O4S — CID 39311068
2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-phenylacetamide (PubChem CID 39311068) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-phenylacetamide.
| Compound Name | 2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 39311068 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@H]1C(=O)NCCN1S(=O)(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H19N3O4S/c22-17(20-14-7-3-1-4-8-14)13-16-18(23)19-11-12-21(16)26(24,25)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,19,23)(H,20,22)/t16-/m0/s1 |
| InChIKey | SYWWEMGCSXFKFV-INIZCTEOSA-N |
| XLogP | 1.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |