C21H24N4O6S — CID 51718679
2-[(2S)-1-(4-acetamidophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 51718679) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[(2S)-1-(4-acetamidophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(2S)-1-(4-acetamidophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51718679 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[(2S)-1-(4-acetamidophenyl)sulfonyl-3-oxopiperazin-2-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)C[C@H]1C(=O)NCCN1S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C21H24N4O6S/c1-14(26)23-15-7-9-16(10-8-15)32(29,30)25-12-11-22-21(28)18(25)13-20(27)24-17-5-3-4-6-19(17)31-2/h3-10,18H,11-13H2,1-2H3,(H,22,28)(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | RHMAHZCRPNARSM-SFHVURJKSA-N |
| XLogP | 1.17 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |