C19H21N3O4S2 — CID 45495296
2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 45495296) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 45495296 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CC2C(=O)NCCN2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-27-15-7-5-6-14(12-15)21-18(23)13-17-19(24)20-10-11-22(17)28(25,26)16-8-3-2-4-9-16/h2-9,12,17H,10-11,13H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | YJEKNEYWYHFZOK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |