C21H19N3O6S — CID 42656185
2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2-oxochromen-6-yl)acetamide (PubChem CID 42656185) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 42656185 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-(2-oxochromen-6-yl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1S(=O)(=O)c1ccccc1)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C21H19N3O6S/c25-19(23-15-7-8-18-14(12-15)6-9-20(26)30-18)13-17-21(27)22-10-11-24(17)31(28,29)16-4-2-1-3-5-16/h1-9,12,17H,10-11,13H2,(H,22,27)(H,23,25) |
| InChIKey | MJBXQNOFBUMUNY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|