C16H21N3O6S — CID 51716885
methyl 3-[[2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]acetyl]amino]propanoate (PubChem CID 51716885) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is methyl 3-[[2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]acetyl]amino]propanoate.
| Compound Name | methyl 3-[[2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 51716885 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl 3-[[2-[(2S)-1-(benzenesulfonyl)-3-oxopiperazin-2-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)C[C@H]1C(=O)NCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O6S/c1-25-15(21)7-8-17-14(20)11-13-16(22)18-9-10-19(13)26(23,24)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,17,20)(H,18,22)/t13-/m0/s1 |
| InChIKey | KHYXZTOJBJDSPG-ZDUSSCGKSA-N |
| XLogP | -0.75 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |