C20H23N3O5S — CID 42655576
2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 42655576) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 42655576 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-3-oxopiperazin-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)CC1C(=O)NCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-28-18-10-6-5-7-15(18)14-22-19(24)13-17-20(25)21-11-12-23(17)29(26,27)16-8-3-2-4-9-16/h2-10,17H,11-14H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | OAWDGQBCGUMFPJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |