C20H25N3O6S — CID 122268483
methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonyl-4-methoxybenzoate (PubChem CID 122268483) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonyl-4-methoxybenzoate.
| Compound Name | methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonyl-4-methoxybenzoate |
|---|---|
| PubChem CID | 122268483 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonyl-4-methoxybenzoate |
| SMILES | CCc1cnc(OC2CCCN(S(=O)(=O)c3cc(C(=O)OC)ccc3OC)C2)nc1 |
| InChI | InChI=1S/C20H25N3O6S/c1-4-14-11-21-20(22-12-14)29-16-6-5-9-23(13-16)30(25,26)18-10-15(19(24)28-3)7-8-17(18)27-2/h7-8,10-12,16H,4-6,9,13H2,1-3H3 |
| InChIKey | KYLNQMADHZFRNO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |