C24H29FN2O4S — CID 90617002
1-[4-[4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 90617002) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is 1-[4-[4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 90617002 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[4-[4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(N3CCC(Oc4ccccc4F)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H29FN2O4S/c1-18(28)19-6-8-22(9-7-19)32(29,30)27-16-10-20(11-17-27)26-14-12-21(13-15-26)31-24-5-3-2-4-23(24)25/h2-9,20-21H,10-17H2,1H3 |
| InChIKey | JOPOJCOWXIXQMV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |