C15H17F4NO2 — CID 124607460
(2-ethoxy-3-fluorophenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 124607460) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is (2-ethoxy-3-fluorophenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (2-ethoxy-3-fluorophenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124607460 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2-ethoxy-3-fluorophenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | CCOc1c(F)cccc1C(=O)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H17F4NO2/c1-2-22-13-11(6-3-7-12(13)16)14(21)20-8-4-5-10(9-20)15(17,18)19/h3,6-7,10H,2,4-5,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | WOYVUGDYYKHMOR-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |