C22H21F3N4O4 — CID 122267578
2-[4-oxo-4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 122267578) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-[4-oxo-4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-oxo-4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122267578 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[4-oxo-4-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C22H21F3N4O4/c23-22(24,25)17-9-10-26-21(27-17)33-14-5-3-11-28(13-14)18(30)8-4-12-29-19(31)15-6-1-2-7-16(15)20(29)32/h1-2,6-7,9-10,14H,3-5,8,11-13H2 |
| InChIKey | PDUBMEHCDMXPDL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|