C14H17BrF3N3O2 — CID 122267520
4-bromo-1-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butan-1-one (PubChem CID 122267520) has the molecular formula C14H17BrF3N3O2 and a molecular weight of 396.21 g/mol. Its IUPAC name is 4-bromo-1-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butan-1-one.
| Compound Name | 4-bromo-1-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 122267520 |
| Molecular Formula | C14H17BrF3N3O2 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 4-bromo-1-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCBr)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C14H17BrF3N3O2/c15-6-1-4-12(22)21-8-2-3-10(9-21)23-13-19-7-5-11(20-13)14(16,17)18/h5,7,10H,1-4,6,8-9H2 |
| InChIKey | TVYLFTCJNTXMPS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|