C19H16F3N3O3 — CID 122267512
1-benzofuran-2-yl-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone (PubChem CID 122267512) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122267512 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-benzofuran-2-yl-[3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C19H16F3N3O3/c20-19(21,22)16-7-8-23-18(24-16)27-13-5-3-9-25(11-13)17(26)15-10-12-4-1-2-6-14(12)28-15/h1-2,4,6-8,10,13H,3,5,9,11H2 |
| InChIKey | GAFZHBYSYKFJOW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |