C19H19N3O4 — CID 122257503
(5-methoxy-1-benzofuran-2-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone (PubChem CID 122257503) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (5-methoxy-1-benzofuran-2-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone.
| Compound Name | (5-methoxy-1-benzofuran-2-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 122257503 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (5-methoxy-1-benzofuran-2-yl)-(3-pyrimidin-2-yloxypiperidin-1-yl)methanone |
| SMILES | COc1ccc2oc(C(=O)N3CCCC(Oc4ncccn4)C3)cc2c1 |
| InChI | InChI=1S/C19H19N3O4/c1-24-14-5-6-16-13(10-14)11-17(26-16)18(23)22-9-2-4-15(12-22)25-19-20-7-3-8-21-19/h3,5-8,10-11,15H,2,4,9,12H2,1H3 |
| InChIKey | LLRNKRWNENTNHA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |