C15H22N2O3 — CID 95482231
1,4-diazepan-1-yl-(2,5-dimethoxy-4-methylphenyl)methanone (PubChem CID 95482231) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(2,5-dimethoxy-4-methylphenyl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(2,5-dimethoxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 95482231 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1,4-diazepan-1-yl-(2,5-dimethoxy-4-methylphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCCNCC2)c(OC)cc1C |
| InChI | InChI=1S/C15H22N2O3/c1-11-9-14(20-3)12(10-13(11)19-2)15(18)17-7-4-5-16-6-8-17/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | UJZFUPSYINFFJO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |