C21H25N3O4 — CID 119417744
N-[2-(1,4-diazepane-1-carbonyl)-4,5-dimethoxyphenyl]benzamide (PubChem CID 119417744) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-(1,4-diazepane-1-carbonyl)-4,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[2-(1,4-diazepane-1-carbonyl)-4,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 119417744 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-(1,4-diazepane-1-carbonyl)-4,5-dimethoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(C(=O)N2CCCNCC2)cc1OC |
| InChI | InChI=1S/C21H25N3O4/c1-27-18-13-16(21(26)24-11-6-9-22-10-12-24)17(14-19(18)28-2)23-20(25)15-7-4-3-5-8-15/h3-5,7-8,13-14,22H,6,9-12H2,1-2H3,(H,23,25) |
| InChIKey | FNWMBTHGDHJDTF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |