C11H12N4O7 — CID 3469130
2-[2-(4,5-dimethoxy-2-nitrobenzoyl)hydrazinyl]-2-oxoacetamide (PubChem CID 3469130) has the molecular formula C11H12N4O7 and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-[2-(4,5-dimethoxy-2-nitrobenzoyl)hydrazinyl]-2-oxoacetamide.
| Compound Name | 2-[2-(4,5-dimethoxy-2-nitrobenzoyl)hydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 3469130 |
| Molecular Formula | C11H12N4O7 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[2-(4,5-dimethoxy-2-nitrobenzoyl)hydrazinyl]-2-oxoacetamide |
| SMILES | COc1cc(C(=O)NNC(=O)C(N)=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C11H12N4O7/c1-21-7-3-5(6(15(19)20)4-8(7)22-2)10(17)13-14-11(18)9(12)16/h3-4H,1-2H3,(H2,12,16)(H,13,17)(H,14,18) |
| InChIKey | OCAGIYOSYUUNGG-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 162.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|