C15H18N4O6 — CID 56509182
N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dimethoxy-N-methyl-2-nitrobenzamide (PubChem CID 56509182) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dimethoxy-N-methyl-2-nitrobenzamide.
| Compound Name | N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dimethoxy-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 56509182 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-4,5-dimethoxy-N-methyl-2-nitrobenzamide |
| SMILES | CCc1noc(CN(C)C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H18N4O6/c1-5-13-16-14(25-17-13)8-18(2)15(20)9-6-11(23-3)12(24-4)7-10(9)19(21)22/h6-7H,5,8H2,1-4H3 |
| InChIKey | HSLVNJTURUTKDQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|