C19H20Cl2N2O6 — CID 24563230
N-[(3,4-dichlorophenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-N-methyl-2-nitrobenzamide (PubChem CID 24563230) has the molecular formula C19H20Cl2N2O6 and a molecular weight of 443.28 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-N-methyl-2-nitrobenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 24563230 |
| Molecular Formula | C19H20Cl2N2O6 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-5-methoxy-4-(2-methoxyethoxy)-N-methyl-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H20Cl2N2O6/c1-22(11-12-4-5-14(20)15(21)8-12)19(24)13-9-17(28-3)18(29-7-6-27-2)10-16(13)23(25)26/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | CJRLIGLNWNDAEA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|