C17H18ClNO2 — CID 104667249
4-chloro-2-methoxy-6-[(2-methyl-2,3-dihydroindol-1-yl)methyl]phenol (PubChem CID 104667249) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[(2-methyl-2,3-dihydroindol-1-yl)methyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[(2-methyl-2,3-dihydroindol-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 104667249 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-chloro-2-methoxy-6-[(2-methyl-2,3-dihydroindol-1-yl)methyl]phenol |
| SMILES | COc1cc(Cl)cc(CN2c3ccccc3CC2C)c1O |
| InChI | InChI=1S/C17H18ClNO2/c1-11-7-12-5-3-4-6-15(12)19(11)10-13-8-14(18)9-16(21-2)17(13)20/h3-6,8-9,11,20H,7,10H2,1-2H3 |
| InChIKey | IDFJPSDLAMHOQD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|