C17H12FN3O4S — CID 16573795
N-(4-fluoro-3-nitrophenyl)-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide (PubChem CID 16573795) has the molecular formula C17H12FN3O4S and a molecular weight of 373.37 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide |
|---|---|
| PubChem CID | 16573795 |
| Molecular Formula | C17H12FN3O4S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide |
| SMILES | O=C1CCC2(C(=O)Nc3ccc(F)c([N+](=O)[O-])c3)Sc3ccccc3N12 |
| InChI | InChI=1S/C17H12FN3O4S/c18-11-6-5-10(9-13(11)21(24)25)19-16(23)17-8-7-15(22)20(17)12-3-1-2-4-14(12)26-17/h1-6,9H,7-8H2,(H,19,23) |
| InChIKey | TUCWHNQOBSMZSJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|