C19H17FN2O3S — CID 55675350
N-[2-(3-fluorophenoxy)ethyl]-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide (PubChem CID 55675350) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide |
|---|---|
| PubChem CID | 55675350 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxamide |
| SMILES | O=C1CCC2(C(=O)NCCOc3cccc(F)c3)Sc3ccccc3N12 |
| InChI | InChI=1S/C19H17FN2O3S/c20-13-4-3-5-14(12-13)25-11-10-21-18(24)19-9-8-17(23)22(19)15-6-1-2-7-16(15)26-19/h1-7,12H,8-11H2,(H,21,24) |
| InChIKey | BNRDEBVZUWLGFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|