C18H22N2O4S — CID 120524064
7-[(1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carbonyl)amino]heptanoic acid (PubChem CID 120524064) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 7-[(1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 120524064 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 7-[(1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C12CCC(=O)N1c1ccccc1S2 |
| InChI | InChI=1S/C18H22N2O4S/c21-15-10-11-18(20(15)13-7-4-5-8-14(13)25-18)17(24)19-12-6-2-1-3-9-16(22)23/h4-5,7-8H,1-3,6,9-12H2,(H,19,24)(H,22,23) |
| InChIKey | JSGUTLLDPYWZQW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|