C19H14ClN3O6S — CID 5191667
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate (PubChem CID 5191667) has the molecular formula C19H14ClN3O6S and a molecular weight of 447.86 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
|---|---|
| PubChem CID | 5191667 |
| Molecular Formula | C19H14ClN3O6S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
| SMILES | O=C(COC(=O)C12CCC(=O)N1c1ccccc1S2)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14ClN3O6S/c20-11-5-6-12(14(9-11)23(27)28)21-16(24)10-29-18(26)19-8-7-17(25)22(19)13-3-1-2-4-15(13)30-19/h1-6,9H,7-8,10H2,(H,21,24) |
| InChIKey | DSIWWRJSVYOAIM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|