C21H19ClN2O4 — CID 43003624
5-chloro-2-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)benzohydrazide (PubChem CID 43003624) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)benzohydrazide |
|---|---|
| PubChem CID | 43003624 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-chloro-2-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)benzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)C(C)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19ClN2O4/c1-13(28-17-9-7-14-5-3-4-6-15(14)11-17)20(25)23-24-21(26)18-12-16(22)8-10-19(18)27-2/h3-13H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WOSNRWNWZBOKHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|