C17H13BrN6O5 — CID 25162808
N'-[2-(4-bromophenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide (PubChem CID 25162808) has the molecular formula C17H13BrN6O5 and a molecular weight of 461.23 g/mol. Its IUPAC name is N'-[2-(4-bromophenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide.
| Compound Name | N'-[2-(4-bromophenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 25162808 |
| Molecular Formula | C17H13BrN6O5 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | N'-[2-(4-bromophenoxy)acetyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzohydrazide |
| SMILES | O=C(COc1ccc(Br)cc1)NNC(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13BrN6O5/c18-12-2-4-13(5-3-12)29-8-16(25)21-22-17(26)11-1-6-14(15(7-11)24(27)28)23-10-19-9-20-23/h1-7,9-10H,8H2,(H,21,25)(H,22,26) |
| InChIKey | HZIAHKDXJZNLAH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|