C18H16N4O4 — CID 86978714
(4-propan-2-ylphenyl) 3-nitro-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 86978714) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 3-nitro-4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | (4-propan-2-ylphenyl) 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 86978714 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (4-propan-2-ylphenyl) 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | CC(C)c1ccc(OC(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H16N4O4/c1-12(2)13-3-6-15(7-4-13)26-18(23)14-5-8-16(17(9-14)22(24)25)21-11-19-10-20-21/h3-12H,1-2H3 |
| InChIKey | HXHKMOIPFKFYKW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|