C22H17N5O6S — CID 25162075
[4-[benzenesulfonyl(methyl)amino]phenyl] 3-nitro-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 25162075) has the molecular formula C22H17N5O6S and a molecular weight of 479.47 g/mol. Its IUPAC name is [4-[benzenesulfonyl(methyl)amino]phenyl] 3-nitro-4-(1,2,4-triazol-1-yl)benzoate.
| Compound Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 25162075 |
| Molecular Formula | C22H17N5O6S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | CN(c1ccc(OC(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17N5O6S/c1-25(34(31,32)19-5-3-2-4-6-19)17-8-10-18(11-9-17)33-22(28)16-7-12-20(21(13-16)27(29)30)26-15-23-14-24-26/h2-15H,1H3 |
| InChIKey | VZKLZBOYBUXEPZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 137.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|