C19H15FN4O3S — CID 86998016
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 86998016) has the molecular formula C19H15FN4O3S and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86998016 |
| Molecular Formula | C19H15FN4O3S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCSc2c(F)cccc21)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C19H15FN4O3S/c20-16-3-1-2-15-17(8-9-28-18(15)16)22-19(25)12-10-21-23(11-12)13-4-6-14(7-5-13)24(26)27/h1-7,10-11,17H,8-9H2,(H,22,25) |
| InChIKey | PNQWUSOALLSHMO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|