C14H17Cl2F3N4O3 — CID 120812018
3-chloro-2-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 120812018) has the molecular formula C14H17Cl2F3N4O3 and a molecular weight of 417.22 g/mol. Its IUPAC name is 3-chloro-2-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 3-chloro-2-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120812018 |
| Molecular Formula | C14H17Cl2F3N4O3 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-chloro-2-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCC(N1CCNCC1)C(F)(F)F)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16ClF3N4O3.ClH/c15-10-3-1-2-9(12(10)22(24)25)13(23)20-8-11(14(16,17)18)21-6-4-19-5-7-21;/h1-3,11,19H,4-8H2,(H,20,23);1H |
| InChIKey | ZIXOJCHVZKWHPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|