C20H23F3N4O — CID 120811339
2-anilino-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120811339) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-anilino-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2-anilino-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120811339 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-anilino-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(NCC(N1CCNCC1)C(F)(F)F)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C20H23F3N4O/c21-20(22,23)18(27-12-10-24-11-13-27)14-25-19(28)16-8-4-5-9-17(16)26-15-6-2-1-3-7-15/h1-9,18,24,26H,10-14H2,(H,25,28) |
| InChIKey | JXNLYFCUAVTXKF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |