C20H28F3N3O2 — CID 120812343
2-cyclohexyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120812343) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2-cyclohexyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120812343 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-cyclohexyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(NCC(N1CCNCC1)C(F)(F)F)c1ccccc1OC1CCCCC1 |
| InChI | InChI=1S/C20H28F3N3O2/c21-20(22,23)18(26-12-10-24-11-13-26)14-25-19(27)16-8-4-5-9-17(16)28-15-6-2-1-3-7-15/h4-5,8-9,15,18,24H,1-3,6-7,10-14H2,(H,25,27) |
| InChIKey | NQCIQRJAYXGONO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |