C14H16ClF6N3O — CID 120811198
2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 120811198) has the molecular formula C14H16ClF6N3O and a molecular weight of 391.74 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120811198 |
| Molecular Formula | C14H16ClF6N3O |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCC(N1CCNCC1)C(F)(F)F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H15F6N3O.ClH/c15-9-2-1-8(11(16)12(9)17)13(24)22-7-10(14(18,19)20)23-5-3-21-4-6-23;/h1-2,10,21H,3-7H2,(H,22,24);1H |
| InChIKey | QTTOKZQKLUQGMG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|