C16H22F3N3O — CID 120813497
2,4-dimethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120813497) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 2,4-dimethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2,4-dimethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120813497 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2,4-dimethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCC(N2CCNCC2)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C16H22F3N3O/c1-11-3-4-13(12(2)9-11)15(23)21-10-14(16(17,18)19)22-7-5-20-6-8-22/h3-4,9,14,20H,5-8,10H2,1-2H3,(H,21,23) |
| InChIKey | XGGWVWVRMSTPME-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |