C15H21F3N4O3S — CID 120813829
2-(methanesulfonamido)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120813829) has the molecular formula C15H21F3N4O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2-(methanesulfonamido)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120813829 |
| Molecular Formula | C15H21F3N4O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(methanesulfonamido)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N4O3S/c1-26(24,25)21-12-5-3-2-4-11(12)14(23)20-10-13(15(16,17)18)22-8-6-19-7-9-22/h2-5,13,19,21H,6-10H2,1H3,(H,20,23) |
| InChIKey | QZFCESZZUSNABL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |