C17H22F3N3O2 — CID 120813289
2-prop-2-enoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120813289) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-prop-2-enoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 2-prop-2-enoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120813289 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-prop-2-enoxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | C=CCOc1ccccc1C(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3N3O2/c1-2-11-25-14-6-4-3-5-13(14)16(24)22-12-15(17(18,19)20)23-9-7-21-8-10-23/h2-6,15,21H,1,7-12H2,(H,22,24) |
| InChIKey | HFNISIUVKURVEJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|