C15H20F3N5O3 — CID 120810717
2-(2-nitroanilino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120810717) has the molecular formula C15H20F3N5O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-(2-nitroanilino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(2-nitroanilino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120810717 |
| Molecular Formula | C15H20F3N5O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(2-nitroanilino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(CNc1ccccc1[N+](=O)[O-])NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N5O3/c16-15(17,18)13(22-7-5-19-6-8-22)9-21-14(24)10-20-11-3-1-2-4-12(11)23(25)26/h1-4,13,19-20H,5-10H2,(H,21,24) |
| InChIKey | LYJLFNUVWPLAQU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|