C14H20ClF3N4O4S — CID 120778853
2-methyl-3-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride (PubChem CID 120778853) has the molecular formula C14H20ClF3N4O4S and a molecular weight of 432.85 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-methyl-3-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120778853 |
| Molecular Formula | C14H20ClF3N4O4S |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-methyl-3-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)NCC(N1CCNCC1)C(F)(F)F.Cl |
| InChI | InChI=1S/C14H19F3N4O4S.ClH/c1-10-11(21(22)23)3-2-4-12(10)26(24,25)19-9-13(14(15,16)17)20-7-5-18-6-8-20;/h2-4,13,18-19H,5-9H2,1H3;1H |
| InChIKey | DQWIVKKKHRUYOD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|