C13H16ClF6N3O2S — CID 120778859
2,4,5-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride (PubChem CID 120778859) has the molecular formula C13H16ClF6N3O2S and a molecular weight of 427.80 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2,4,5-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120778859 |
| Molecular Formula | C13H16ClF6N3O2S |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2,4,5-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCC(N1CCNCC1)C(F)(F)F)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H15F6N3O2S.ClH/c14-8-5-10(16)11(6-9(8)15)25(23,24)21-7-12(13(17,18)19)22-3-1-20-2-4-22;/h5-6,12,20-21H,1-4,7H2;1H |
| InChIKey | SHGFJMRSGWQEHU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|