C13H15F6N3O2S — CID 120778702
2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 120778702) has the molecular formula C13H15F6N3O2S and a molecular weight of 391.34 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120778702 |
| Molecular Formula | C13H15F6N3O2S |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2,3,4-trifluoro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(N1CCNCC1)C(F)(F)F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H15F6N3O2S/c14-8-1-2-9(12(16)11(8)15)25(23,24)21-7-10(13(17,18)19)22-5-3-20-4-6-22/h1-2,10,20-21H,3-7H2 |
| InChIKey | HDTFLLGSFRVDKN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|