C13H20F3N5O — CID 120810613
3-pyrazol-1-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (PubChem CID 120810613) has the molecular formula C13H20F3N5O and a molecular weight of 319.33 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
| Compound Name | 3-pyrazol-1-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 120810613 |
| Molecular Formula | C13H20F3N5O |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-pyrazol-1-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| SMILES | O=C(CCn1cccn1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N5O/c14-13(15,16)11(20-8-4-17-5-9-20)10-18-12(22)2-7-21-6-1-3-19-21/h1,3,6,11,17H,2,4-5,7-10H2,(H,18,22) |
| InChIKey | WBTUPWHOBFJRCW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |