C10H14BrN3O3S2 — CID 167891528
3-[2-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 167891528) has the molecular formula C10H14BrN3O3S2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 3-[2-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167891528 |
| Molecular Formula | C10H14BrN3O3S2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 3-[2-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | Cc1[nH]nc(C(=O)NCCSSCCC(=O)O)c1Br |
| InChI | InChI=1S/C10H14BrN3O3S2/c1-6-8(11)9(14-13-6)10(17)12-3-5-19-18-4-2-7(15)16/h2-5H2,1H3,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | XPRFGJUSNRKUFO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|