C13H20N2O4 — CID 43406076
methyl 6-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoate (PubChem CID 43406076) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 6-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 43406076 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methyl 6-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1c(C)noc1C |
| InChI | InChI=1S/C13H20N2O4/c1-9-12(10(2)19-15-9)13(17)14-8-6-4-5-7-11(16)18-3/h4-8H2,1-3H3,(H,14,17) |
| InChIKey | IFYLWERWTFCOES-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|