C21H30N6O — CID 109354483
N-[4-(4-methylpiperazin-1-yl)phenyl]-6-(pentylamino)pyrimidine-4-carboxamide (PubChem CID 109354483) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-6-(pentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-6-(pentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109354483 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-6-(pentylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCCNc1cc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)ncn1 |
| InChI | InChI=1S/C21H30N6O/c1-3-4-5-10-22-20-15-19(23-16-24-20)21(28)25-17-6-8-18(9-7-17)27-13-11-26(2)12-14-27/h6-9,15-16H,3-5,10-14H2,1-2H3,(H,25,28)(H,22,23,24) |
| InChIKey | YZPWNVJYQVDTHM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|