C14H25N5 — CID 112857956
6-(4-methylpiperazin-1-yl)-N-pentylpyrimidin-4-amine (PubChem CID 112857956) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-N-pentylpyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-N-pentylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112857956 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-N-pentylpyrimidin-4-amine |
| SMILES | CCCCCNc1cc(N2CCN(C)CC2)ncn1 |
| InChI | InChI=1S/C14H25N5/c1-3-4-5-6-15-13-11-14(17-12-16-13)19-9-7-18(2)8-10-19/h11-12H,3-10H2,1-2H3,(H,15,16,17) |
| InChIKey | XRSOTWFBWOSEAJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|