C15H18N4 — CID 80822758
6-(1,3-dihydroisoindol-2-yl)-N-propylpyrimidin-4-amine (PubChem CID 80822758) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 6-(1,3-dihydroisoindol-2-yl)-N-propylpyrimidin-4-amine.
| Compound Name | 6-(1,3-dihydroisoindol-2-yl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80822758 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-(1,3-dihydroisoindol-2-yl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(N2Cc3ccccc3C2)ncn1 |
| InChI | InChI=1S/C15H18N4/c1-2-7-16-14-8-15(18-11-17-14)19-9-12-5-3-4-6-13(12)10-19/h3-6,8,11H,2,7,9-10H2,1H3,(H,16,17,18) |
| InChIKey | BODYRGUEBFBMSY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |