C17H22N4 — CID 112855480
N-butan-2-yl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-4-amine (PubChem CID 112855480) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-butan-2-yl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-4-amine.
| Compound Name | N-butan-2-yl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112855480 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-butan-2-yl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-4-amine |
| SMILES | CCC(C)Nc1cc(N2CCc3ccccc3C2)ncn1 |
| InChI | InChI=1S/C17H22N4/c1-3-13(2)20-16-10-17(19-12-18-16)21-9-8-14-6-4-5-7-15(14)11-21/h4-7,10,12-13H,3,8-9,11H2,1-2H3,(H,18,19,20) |
| InChIKey | PDAPWBYXWRSTFA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |